C32H42O4 — CID 90815558
1,3-bis[2-[4-(1-ethoxyethoxy)phenyl]propan-2-yl]benzene (PubChem CID 90815558) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is 1,3-bis[2-[4-(1-ethoxyethoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1,3-bis[2-[4-(1-ethoxyethoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 90815558 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 1,3-bis[2-[4-(1-ethoxyethoxy)phenyl]propan-2-yl]benzene |
| SMILES | CCOC(C)Oc1ccc(C(C)(C)c2cccc(C(C)(C)c3ccc(OC(C)OCC)cc3)c2)cc1 |
| InChI | InChI=1S/C32H42O4/c1-9-33-23(3)35-29-18-14-25(15-19-29)31(5,6)27-12-11-13-28(22-27)32(7,8)26-16-20-30(21-17-26)36-24(4)34-10-2/h11-24H,9-10H2,1-8H3 |
| InChIKey | FXIGRJPQAXGFMF-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|