C43H56O6 — CID 59701640
4-[2-[4-[1-[9-[1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]ethoxy]nonoxy]ethoxy]phenyl]propan-2-yl]phenol (PubChem CID 59701640) has the molecular formula C43H56O6 and a molecular weight of 668.92 g/mol. Its IUPAC name is 4-[2-[4-[1-[9-[1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]ethoxy]nonoxy]ethoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[2-[4-[1-[9-[1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]ethoxy]nonoxy]ethoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 59701640 |
| Molecular Formula | C43H56O6 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | 4-[2-[4-[1-[9-[1-[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]ethoxy]nonoxy]ethoxy]phenyl]propan-2-yl]phenol |
| SMILES | CC(OCCCCCCCCCOC(C)Oc1ccc(C(C)(C)c2ccc(O)cc2)cc1)Oc1ccc(C(C)(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C43H56O6/c1-32(48-40-26-18-36(19-27-40)42(3,4)34-14-22-38(44)23-15-34)46-30-12-10-8-7-9-11-13-31-47-33(2)49-41-28-20-37(21-29-41)43(5,6)35-16-24-39(45)25-17-35/h14-29,32-33,44-45H,7-13,30-31H2,1-6H3 |
| InChIKey | HTVAOFXWQRLTLY-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|