C18H31NO2 — CID 123713029
3-[3-(1-ethoxyethoxy)phenyl]-2,5-dimethylhexan-2-amine (PubChem CID 123713029) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 3-[3-(1-ethoxyethoxy)phenyl]-2,5-dimethylhexan-2-amine.
| Compound Name | 3-[3-(1-ethoxyethoxy)phenyl]-2,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 123713029 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 3-[3-(1-ethoxyethoxy)phenyl]-2,5-dimethylhexan-2-amine |
| SMILES | CCOC(C)Oc1cccc(C(CC(C)C)C(C)(C)N)c1 |
| InChI | InChI=1S/C18H31NO2/c1-7-20-14(4)21-16-10-8-9-15(12-16)17(11-13(2)3)18(5,6)19/h8-10,12-14,17H,7,11,19H2,1-6H3 |
| InChIKey | KWIKKUUEKSHQGD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|