C38H62O5 — CID 91495953
5-(2,5-dimethylhexan-3-yl)-2-(1-ethoxypropoxy)-3-[2-[1-[3-(2,5,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethyl]phenol (PubChem CID 91495953) has the molecular formula C38H62O5 and a molecular weight of 598.91 g/mol. Its IUPAC name is 5-(2,5-dimethylhexan-3-yl)-2-(1-ethoxypropoxy)-3-[2-[1-[3-(2,5,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethyl]phenol.
| Compound Name | 5-(2,5-dimethylhexan-3-yl)-2-(1-ethoxypropoxy)-3-[2-[1-[3-(2,5,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethyl]phenol |
|---|---|
| PubChem CID | 91495953 |
| Molecular Formula | C38H62O5 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.46 |
| IUPAC Name | 5-(2,5-dimethylhexan-3-yl)-2-(1-ethoxypropoxy)-3-[2-[1-[3-(2,5,5-trimethylhexan-3-yl)phenoxy]ethoxy]ethyl]phenol |
| SMILES | CCOC(CC)Oc1c(O)cc(C(CC(C)C)C(C)C)cc1CCOC(C)Oc1cccc(C(CC(C)(C)C)C(C)C)c1 |
| InChI | InChI=1S/C38H62O5/c1-13-36(40-14-2)43-37-30(21-31(23-35(37)39)33(26(5)6)20-25(3)4)18-19-41-28(9)42-32-17-15-16-29(22-32)34(27(7)8)24-38(10,11)12/h15-17,21-23,25-28,33-34,36,39H,13-14,18-20,24H2,1-12H3 |
| InChIKey | QSOBWQNQJFRLEP-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|