C26H36O5 — CID 123920896
2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl 4-methoxybenzoate (PubChem CID 123920896) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl 4-methoxybenzoate.
| Compound Name | 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 123920896 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethoxy]ethyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCOC(C)Oc2ccc(C(CC(C)C)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H36O5/c1-18(2)17-25(19(3)4)21-7-13-24(14-8-21)31-20(5)29-15-16-30-26(27)22-9-11-23(28-6)12-10-22/h7-14,18-20,25H,15-17H2,1-6H3 |
| InChIKey | IKLSRHPDHFWIRO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|