C21H34O4 — CID 143762717
methyl 2-(1-ethoxyethoxy)-5-(2,5,5-trimethylhexan-3-yl)benzoate (PubChem CID 143762717) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl 2-(1-ethoxyethoxy)-5-(2,5,5-trimethylhexan-3-yl)benzoate.
| Compound Name | methyl 2-(1-ethoxyethoxy)-5-(2,5,5-trimethylhexan-3-yl)benzoate |
|---|---|
| PubChem CID | 143762717 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl 2-(1-ethoxyethoxy)-5-(2,5,5-trimethylhexan-3-yl)benzoate |
| SMILES | CCOC(C)Oc1ccc(C(CC(C)(C)C)C(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C21H34O4/c1-9-24-15(4)25-19-11-10-16(12-17(19)20(22)23-8)18(14(2)3)13-21(5,6)7/h10-12,14-15,18H,9,13H2,1-8H3 |
| InChIKey | NSAOCYUGDLDRRJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|