C24H34N2O5 — CID 21488920
2-(1-ethoxyethoxy)-5-[1-hydroxy-2-[4-(4-methoxyphenyl)butan-2-ylamino]ethyl]benzamide (PubChem CID 21488920) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-(1-ethoxyethoxy)-5-[1-hydroxy-2-[4-(4-methoxyphenyl)butan-2-ylamino]ethyl]benzamide.
| Compound Name | 2-(1-ethoxyethoxy)-5-[1-hydroxy-2-[4-(4-methoxyphenyl)butan-2-ylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 21488920 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-(1-ethoxyethoxy)-5-[1-hydroxy-2-[4-(4-methoxyphenyl)butan-2-ylamino]ethyl]benzamide |
| SMILES | CCOC(C)Oc1ccc(C(O)CNC(C)CCc2ccc(OC)cc2)cc1C(N)=O |
| InChI | InChI=1S/C24H34N2O5/c1-5-30-17(3)31-23-13-10-19(14-21(23)24(25)28)22(27)15-26-16(2)6-7-18-8-11-20(29-4)12-9-18/h8-14,16-17,22,26-27H,5-7,15H2,1-4H3,(H2,25,28) |
| InChIKey | BTRWUMDEOBEDDT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|