C15H24N2O4 — CID 21488897
5-[2-(butan-2-ylamino)-1-hydroxyethyl]-2-(2-hydroxyethoxy)benzamide (PubChem CID 21488897) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-[2-(butan-2-ylamino)-1-hydroxyethyl]-2-(2-hydroxyethoxy)benzamide.
| Compound Name | 5-[2-(butan-2-ylamino)-1-hydroxyethyl]-2-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 21488897 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 5-[2-(butan-2-ylamino)-1-hydroxyethyl]-2-(2-hydroxyethoxy)benzamide |
| SMILES | CCC(C)NCC(O)c1ccc(OCCO)c(C(N)=O)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-3-10(2)17-9-13(19)11-4-5-14(21-7-6-18)12(8-11)15(16)20/h4-5,8,10,13,17-19H,3,6-7,9H2,1-2H3,(H2,16,20) |
| InChIKey | BQOOOIJDJQUSGA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |