C23H33ClN2O4 — CID 21488915
2-(2-ethoxyethoxy)-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzamide;hydrochloride (PubChem CID 21488915) has the molecular formula C23H33ClN2O4 and a molecular weight of 436.98 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 2-(2-ethoxyethoxy)-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 21488915 |
| Molecular Formula | C23H33ClN2O4 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-(2-ethoxyethoxy)-5-[1-hydroxy-2-(4-phenylbutan-2-ylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCOCCOc1ccc(C(O)CNC(C)CCc2ccccc2)cc1C(N)=O.Cl |
| InChI | InChI=1S/C23H32N2O4.ClH/c1-3-28-13-14-29-22-12-11-19(15-20(22)23(24)27)21(26)16-25-17(2)9-10-18-7-5-4-6-8-18;/h4-8,11-12,15,17,21,25-26H,3,9-10,13-14,16H2,1-2H3,(H2,24,27);1H |
| InChIKey | VIISEMLEEODZGG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|