C21H26N2O5 — CID 12814758
methyl 4-[3-[[2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl]amino]butyl]benzoate (PubChem CID 12814758) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 4-[3-[[2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl]amino]butyl]benzoate.
| Compound Name | methyl 4-[3-[[2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl]amino]butyl]benzoate |
|---|---|
| PubChem CID | 12814758 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | methyl 4-[3-[[2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl]amino]butyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC(C)NCC(O)c2ccc(O)c(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-13(3-4-14-5-7-15(8-6-14)21(27)28-2)23-12-19(25)16-9-10-18(24)17(11-16)20(22)26/h5-11,13,19,23-25H,3-4,12H2,1-2H3,(H2,22,26) |
| InChIKey | JLEVYSCJHLSCAF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |