C20H25NO4 — CID 70592210
methyl 3-[(3R)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]benzoate (PubChem CID 70592210) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is methyl 3-[(3R)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]benzoate.
| Compound Name | methyl 3-[(3R)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]benzoate |
|---|---|
| PubChem CID | 70592210 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl 3-[(3R)-3-[[2-hydroxy-2-(4-hydroxyphenyl)ethyl]amino]butyl]benzoate |
| SMILES | COC(=O)c1cccc(CC[C@@H](C)NCC(O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C20H25NO4/c1-14(21-13-19(23)16-8-10-18(22)11-9-16)6-7-15-4-3-5-17(12-15)20(24)25-2/h3-5,8-12,14,19,21-23H,6-7,13H2,1-2H3/t14-,19?/m1/s1 |
| InChIKey | DAHIRXBMRRZFJW-MJTSIZKDSA-N |
| XLogP | 2.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |