C20H26ClN3O3 — CID 54053048
5-[2-[4-(4-chloro-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide (PubChem CID 54053048) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is 5-[2-[4-(4-chloro-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide.
| Compound Name | 5-[2-[4-(4-chloro-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 54053048 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 5-[2-[4-(4-chloro-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
| SMILES | CC(CCN(C)c1ccc(Cl)cc1)NCC(O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C20H26ClN3O3/c1-13(9-10-24(2)16-6-4-15(21)5-7-16)23-12-19(26)14-3-8-18(25)17(11-14)20(22)27/h3-8,11,13,19,23,25-26H,9-10,12H2,1-2H3,(H2,22,27) |
| InChIKey | LUHGJYJXVQZQDW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |