C23H34N2O4S — CID 54468977
4-[2-[4-(4-ethoxy-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-ethylsulfinylphenol (PubChem CID 54468977) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is 4-[2-[4-(4-ethoxy-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-ethylsulfinylphenol.
| Compound Name | 4-[2-[4-(4-ethoxy-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-ethylsulfinylphenol |
|---|---|
| PubChem CID | 54468977 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[2-[4-(4-ethoxy-N-methylanilino)butan-2-ylamino]-1-hydroxyethyl]-2-ethylsulfinylphenol |
| SMILES | CCOc1ccc(N(C)CCC(C)NCC(O)c2ccc(O)c(S(=O)CC)c2)cc1 |
| InChI | InChI=1S/C23H34N2O4S/c1-5-29-20-10-8-19(9-11-20)25(4)14-13-17(3)24-16-22(27)18-7-12-21(26)23(15-18)30(28)6-2/h7-12,15,17,22,24,26-27H,5-6,13-14,16H2,1-4H3 |
| InChIKey | XGYPYYHYVKLINO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|