C16H17F2NO2 — CID 60897262
1-(3,4-difluorophenyl)-2-(4-ethoxyanilino)ethanol (PubChem CID 60897262) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(4-ethoxyanilino)ethanol.
| Compound Name | 1-(3,4-difluorophenyl)-2-(4-ethoxyanilino)ethanol |
|---|---|
| PubChem CID | 60897262 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(4-ethoxyanilino)ethanol |
| SMILES | CCOc1ccc(NCC(O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H17F2NO2/c1-2-21-13-6-4-12(5-7-13)19-10-16(20)11-3-8-14(17)15(18)9-11/h3-9,16,19-20H,2,10H2,1H3 |
| InChIKey | WYRNCWAWCUYDAW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|