C15H14F3NO2 — CID 60909290
1-(3,4-difluorophenyl)-2-(3-fluoro-4-methoxyanilino)ethanol (PubChem CID 60909290) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(3-fluoro-4-methoxyanilino)ethanol.
| Compound Name | 1-(3,4-difluorophenyl)-2-(3-fluoro-4-methoxyanilino)ethanol |
|---|---|
| PubChem CID | 60909290 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(3-fluoro-4-methoxyanilino)ethanol |
| SMILES | COc1ccc(NCC(O)c2ccc(F)c(F)c2)cc1F |
| InChI | InChI=1S/C15H14F3NO2/c1-21-15-5-3-10(7-13(15)18)19-8-14(20)9-2-4-11(16)12(17)6-9/h2-7,14,19-20H,8H2,1H3 |
| InChIKey | OLONKLNMRHUGLD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|