C14H11ClF3NO — CID 83108562
2-(3-chloro-4-fluoroanilino)-1-(3,4-difluorophenyl)ethanol (PubChem CID 83108562) has the molecular formula C14H11ClF3NO and a molecular weight of 301.70 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)-1-(3,4-difluorophenyl)ethanol.
| Compound Name | 2-(3-chloro-4-fluoroanilino)-1-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 83108562 |
| Molecular Formula | C14H11ClF3NO |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)-1-(3,4-difluorophenyl)ethanol |
| SMILES | OC(CNc1ccc(F)c(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF3NO/c15-10-6-9(2-4-11(10)16)19-7-14(20)8-1-3-12(17)13(18)5-8/h1-6,14,19-20H,7H2 |
| InChIKey | ISSIREYWQNHTPW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |