C9H8ClF4NO — CID 83108551
3-(3-chloro-4-fluoroanilino)-1,1,1-trifluoropropan-2-ol (PubChem CID 83108551) has the molecular formula C9H8ClF4NO and a molecular weight of 257.61 g/mol. Its IUPAC name is 3-(3-chloro-4-fluoroanilino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(3-chloro-4-fluoroanilino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83108551 |
| Molecular Formula | C9H8ClF4NO |
| Molecular Weight | 257.61 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 3-(3-chloro-4-fluoroanilino)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNc1ccc(F)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF4NO/c10-6-3-5(1-2-7(6)11)15-4-8(16)9(12,13)14/h1-3,8,15-16H,4H2 |
| InChIKey | QYYKWULGPJEJJG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |