C9H9ClF3NO2 — CID 126847001
4-chloro-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenol (PubChem CID 126847001) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is 4-chloro-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenol.
| Compound Name | 4-chloro-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenol |
|---|---|
| PubChem CID | 126847001 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-chloro-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenol |
| SMILES | Oc1ccc(Cl)cc1NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H9ClF3NO2/c10-5-1-2-7(15)6(3-5)14-4-8(16)9(11,12)13/h1-3,8,14-16H,4H2 |
| InChIKey | JSBVXMPIBTTXHM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|