C11H13ClF3NO — CID 63902301
3-[1-(4-chlorophenyl)ethylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 63902301) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)ethylamino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[1-(4-chlorophenyl)ethylamino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63902301 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-[1-(4-chlorophenyl)ethylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(NCC(O)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClF3NO/c1-7(8-2-4-9(12)5-3-8)16-6-10(17)11(13,14)15/h2-5,7,10,16-17H,6H2,1H3 |
| InChIKey | LJIIDEMLNNSFBZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |