C16H16ClF2NO — CID 81356349
2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-1-(2,6-difluorophenyl)ethanol (PubChem CID 81356349) has the molecular formula C16H16ClF2NO and a molecular weight of 311.76 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-1-(2,6-difluorophenyl)ethanol.
| Compound Name | 2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 81356349 |
| Molecular Formula | C16H16ClF2NO |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-1-(2,6-difluorophenyl)ethanol |
| SMILES | C[C@@H](NCC(O)c1c(F)cccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClF2NO/c1-10(11-5-7-12(17)8-6-11)20-9-15(21)16-13(18)3-2-4-14(16)19/h2-8,10,15,20-21H,9H2,1H3/t10-,15?/m1/s1 |
| InChIKey | YRVNAVFVYHLEHE-INHVJJQHSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |