C10H11ClF3NO — CID 126846999
3-(4-chloro-2-methylanilino)-1,1,1-trifluoropropan-2-ol (PubChem CID 126846999) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-(4-chloro-2-methylanilino)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(4-chloro-2-methylanilino)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 126846999 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-(4-chloro-2-methylanilino)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc(Cl)ccc1NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H11ClF3NO/c1-6-4-7(11)2-3-8(6)15-5-9(16)10(12,13)14/h2-4,9,15-16H,5H2,1H3 |
| InChIKey | VOPNJMPSDVRJHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |