C18H21F2N2O2+ — CID 9376801
[(1S)-1-(3,4-difluorophenyl)ethyl]-[2-(4-ethoxyanilino)-2-oxoethyl]azanium (PubChem CID 9376801) has the molecular formula C18H21F2N2O2+ and a molecular weight of 335.37 g/mol. Its IUPAC name is [(1S)-1-(3,4-difluorophenyl)ethyl]-[2-(4-ethoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3,4-difluorophenyl)ethyl]-[2-(4-ethoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9376801 |
| Molecular Formula | C18H21F2N2O2+ |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(1S)-1-(3,4-difluorophenyl)ethyl]-[2-(4-ethoxyanilino)-2-oxoethyl]azanium |
| SMILES | CCOc1ccc(NC(=O)C[NH2+][C@@H](C)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-3-24-15-7-5-14(6-8-15)22-18(23)11-21-12(2)13-4-9-16(19)17(20)10-13/h4-10,12,21H,3,11H2,1-2H3,(H,22,23)/p+1/t12-/m0/s1 |
| InChIKey | CNOYWVRUSOJJBN-LBPRGKRZSA-O |
| XLogP | 2.63 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |