C22H25N2O2+ — CID 9397491
[2-(4-ethoxyanilino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397491) has the molecular formula C22H25N2O2+ and a molecular weight of 349.45 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397491 |
| Molecular Formula | C22H25N2O2+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
| SMILES | CCOc1ccc(NC(=O)C[NH2+][C@H](C)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-26-19-13-11-18(12-14-19)24-22(25)15-23-16(2)20-10-6-8-17-7-4-5-9-21(17)20/h4-14,16,23H,3,15H2,1-2H3,(H,24,25)/p+1/t16-/m1/s1 |
| InChIKey | XQLVELBUNASFKB-MRXNPFEDSA-O |
| XLogP | 3.50 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |