C22H25N2O3+ — CID 9397393
[2-(3,4-dimethoxyanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397393) has the molecular formula C22H25N2O3+ and a molecular weight of 365.45 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397393 |
| Molecular Formula | C22H25N2O3+ |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+][C@@H](C)c2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H24N2O3/c1-15(18-10-6-8-16-7-4-5-9-19(16)18)23-14-22(25)24-17-11-12-20(26-2)21(13-17)27-3/h4-13,15,23H,14H2,1-3H3,(H,24,25)/p+1/t15-/m0/s1 |
| InChIKey | UMFQRWCHRVUNOB-HNNXBMFYSA-O |
| XLogP | 3.12 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |