C16H19N2O3+ — CID 9396803
[2-(methoxycarbonylamino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9396803) has the molecular formula C16H19N2O3+ and a molecular weight of 287.34 g/mol. Its IUPAC name is [2-(methoxycarbonylamino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(methoxycarbonylamino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9396803 |
| Molecular Formula | C16H19N2O3+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [2-(methoxycarbonylamino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | COC(=O)NC(=O)C[NH2+][C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H18N2O3/c1-11(17-10-15(19)18-16(20)21-2)13-9-5-7-12-6-3-4-8-14(12)13/h3-9,11,17H,10H2,1-2H3,(H,18,19,20)/p+1/t11-/m0/s1 |
| InChIKey | MENYFBAHBKVDBF-NSHDSACASA-O |
| XLogP | 1.35 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |