C24H29N2O+ — CID 9397352
[2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397352) has the molecular formula C24H29N2O+ and a molecular weight of 361.51 g/mol. Its IUPAC name is [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397352 |
| Molecular Formula | C24H29N2O+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | [2-(2-methyl-6-propan-2-ylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C[NH2+][C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H28N2O/c1-16(2)20-13-7-9-17(3)24(20)26-23(27)15-25-18(4)21-14-8-11-19-10-5-6-12-22(19)21/h5-14,16,18,25H,15H2,1-4H3,(H,26,27)/p+1/t18-/m0/s1 |
| InChIKey | BLVGIIHVLXTKJR-SFHVURJKSA-O |
| XLogP | 4.53 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |