C19H20N3O2S+ — CID 9397868
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397868) has the molecular formula C19H20N3O2S+ and a molecular weight of 354.46 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397868 |
| Molecular Formula | C19H20N3O2S+ |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1sccc1C(N)=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H19N3O2S/c1-12(14-8-4-6-13-5-2-3-7-15(13)14)21-11-17(23)22-19-16(18(20)24)9-10-25-19/h2-10,12,21H,11H2,1H3,(H2,20,24)(H,22,23)/p+1/t12-/m0/s1 |
| InChIKey | AENCEWJDTPXNBN-LBPRGKRZSA-O |
| XLogP | 2.26 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |