C21H23N2O+ — CID 9397161
[2-(benzylamino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397161) has the molecular formula C21H23N2O+ and a molecular weight of 319.43 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(benzylamino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397161 |
| Molecular Formula | C21H23N2O+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl]-[(1R)-1-naphthalen-1-ylethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H22N2O/c1-16(19-13-7-11-18-10-5-6-12-20(18)19)22-15-21(24)23-14-17-8-3-2-4-9-17/h2-13,16,22H,14-15H2,1H3,(H,23,24)/p+1/t16-/m1/s1 |
| InChIKey | JKPAJVDQGXMCNV-MRXNPFEDSA-O |
| XLogP | 2.78 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |