C20H19Cl2N2O+ — CID 9397020
[2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397020) has the molecular formula C20H19Cl2N2O+ and a molecular weight of 374.29 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397020 |
| Molecular Formula | C20H19Cl2N2O+ |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1cc(Cl)ccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18Cl2N2O/c1-13(16-8-4-6-14-5-2-3-7-17(14)16)23-12-20(25)24-19-11-15(21)9-10-18(19)22/h2-11,13,23H,12H2,1H3,(H,24,25)/p+1/t13-/m0/s1 |
| InChIKey | QRZVIAFEJLMNQX-ZDUSSCGKSA-O |
| XLogP | 4.41 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |