C21H22BrN2O+ — CID 9397445
[2-(2-bromo-4-methylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium (PubChem CID 9397445) has the molecular formula C21H22BrN2O+ and a molecular weight of 398.32 g/mol. Its IUPAC name is [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium.
| Compound Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
|---|---|
| PubChem CID | 9397445 |
| Molecular Formula | C21H22BrN2O+ |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [2-(2-bromo-4-methylanilino)-2-oxoethyl]-[(1S)-1-naphthalen-1-ylethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH2+][C@@H](C)c2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C21H21BrN2O/c1-14-10-11-20(19(22)12-14)24-21(25)13-23-15(2)17-9-5-7-16-6-3-4-8-18(16)17/h3-12,15,23H,13H2,1-2H3,(H,24,25)/p+1/t15-/m0/s1 |
| InChIKey | PTOVSQJHXRRNAT-HNNXBMFYSA-O |
| XLogP | 4.17 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |