C19H16N2O4S — CID 135390420
4-[(3-carbamoylthiophen-2-yl)amino]-2-naphthalen-1-yl-4-oxobutanoic acid (PubChem CID 135390420) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 4-[(3-carbamoylthiophen-2-yl)amino]-2-naphthalen-1-yl-4-oxobutanoic acid.
| Compound Name | 4-[(3-carbamoylthiophen-2-yl)amino]-2-naphthalen-1-yl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 135390420 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 4-[(3-carbamoylthiophen-2-yl)amino]-2-naphthalen-1-yl-4-oxobutanoic acid |
| SMILES | NC(=O)c1ccsc1NC(=O)CC(C(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H16N2O4S/c20-17(23)14-8-9-26-18(14)21-16(22)10-15(19(24)25)13-7-3-5-11-4-1-2-6-12(11)13/h1-9,15H,10H2,(H2,20,23)(H,21,22)(H,24,25) |
| InChIKey | QCCGKNXSFXBHOF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |