C15H15FN2O2S2 — CID 94812447
2-[[2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 94812447) has the molecular formula C15H15FN2O2S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[[2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 94812447 |
| Molecular Formula | C15H15FN2O2S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-[[2-[(1S)-1-(2-fluorophenyl)ethyl]sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | C[C@H](SCC(=O)Nc1sccc1C(N)=O)c1ccccc1F |
| InChI | InChI=1S/C15H15FN2O2S2/c1-9(10-4-2-3-5-12(10)16)22-8-13(19)18-15-11(14(17)20)6-7-21-15/h2-7,9H,8H2,1H3,(H2,17,20)(H,18,19)/t9-/m0/s1 |
| InChIKey | HZCXIEFPBMXVCB-VIFPVBQESA-N |
| XLogP | 3.42 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |