C15H16N2O2S2 — CID 2498614
2-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiophene-3-carboxamide (PubChem CID 2498614) has the molecular formula C15H16N2O2S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2498614 |
| Molecular Formula | C15H16N2O2S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[[2-[(2-methylphenyl)methylsulfanyl]acetyl]amino]thiophene-3-carboxamide |
| SMILES | Cc1ccccc1CSCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C15H16N2O2S2/c1-10-4-2-3-5-11(10)8-20-9-13(18)17-15-12(14(16)19)6-7-21-15/h2-7H,8-9H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | BEAFEHIGBWMLOR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |