C13H13N3O2S2 — CID 43249185
2-[[2-(2-aminophenyl)sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 43249185) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[[2-(2-aminophenyl)sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(2-aminophenyl)sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43249185 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-[[2-(2-aminophenyl)sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CSc1ccccc1N |
| InChI | InChI=1S/C13H13N3O2S2/c14-9-3-1-2-4-10(9)20-7-11(17)16-13-8(12(15)18)5-6-19-13/h1-6H,7,14H2,(H2,15,18)(H,16,17) |
| InChIKey | SVUFTVHKQXGBFM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|