C10H13N3O4S2 — CID 61142180
(2R)-2-amino-3-[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 61142180) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 61142180 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (2R)-2-amino-3-[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | NC(=O)c1ccsc1NC(=O)CSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H13N3O4S2/c11-6(10(16)17)3-18-4-7(14)13-9-5(8(12)15)1-2-19-9/h1-2,6H,3-4,11H2,(H2,12,15)(H,13,14)(H,16,17)/t6-/m0/s1 |
| InChIKey | UIPJQPCOBFOQEF-LURJTMIESA-N |
| XLogP | -0.07 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |