C17H14N2O2S — CID 16849419
2-[(2-naphthalen-2-ylacetyl)amino]thiophene-3-carboxamide (PubChem CID 16849419) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(2-naphthalen-2-ylacetyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(2-naphthalen-2-ylacetyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 16849419 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[(2-naphthalen-2-ylacetyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H14N2O2S/c18-16(21)14-7-8-22-17(14)19-15(20)10-11-5-6-12-3-1-2-4-13(12)9-11/h1-9H,10H2,(H2,18,21)(H,19,20) |
| InChIKey | IXVMBCBDOWHDQP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |