C22H22N2O5 — CID 90497468
N'-(3,4-dimethoxyphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide (PubChem CID 90497468) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N'-(3,4-dimethoxyphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide.
| Compound Name | N'-(3,4-dimethoxyphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 90497468 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N'-(3,4-dimethoxyphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCC(O)c2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C22H22N2O5/c1-28-19-11-10-15(12-20(19)29-2)24-22(27)21(26)23-13-18(25)17-9-5-7-14-6-3-4-8-16(14)17/h3-12,18,25H,13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | PSIGZDJSMGYGRX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|