C22H20N2O5 — CID 95367281
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]oxamide (PubChem CID 95367281) has the molecular formula C22H20N2O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 95367281 |
| Molecular Formula | C22H20N2O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2R)-2-hydroxy-2-naphthalen-1-ylethyl]oxamide |
| SMILES | O=C(NC[C@H](O)c1cccc2ccccc12)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H20N2O5/c25-18(17-7-3-5-14-4-1-2-6-16(14)17)13-23-21(26)22(27)24-15-8-9-19-20(12-15)29-11-10-28-19/h1-9,12,18,25H,10-11,13H2,(H,23,26)(H,24,27)/t18-/m0/s1 |
| InChIKey | YTJIFFSUVABWOX-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|