C20H22N2O6 — CID 90598239
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-methoxy-2-(2-methoxyphenyl)ethyl]oxamide (PubChem CID 90598239) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-methoxy-2-(2-methoxyphenyl)ethyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-methoxy-2-(2-methoxyphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 90598239 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-methoxy-2-(2-methoxyphenyl)ethyl]oxamide |
| SMILES | COc1ccccc1C(CNC(=O)C(=O)Nc1ccc2c(c1)OCCO2)OC |
| InChI | InChI=1S/C20H22N2O6/c1-25-15-6-4-3-5-14(15)18(26-2)12-21-19(23)20(24)22-13-7-8-16-17(11-13)28-10-9-27-16/h3-8,11,18H,9-10,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | YIAKVGJIQRWJLG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|