C24H26N3O2+ — CID 8695493
[(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium (PubChem CID 8695493) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium.
| Compound Name | [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8695493 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(N2CCCC2=O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25N3O2/c1-17(21-9-4-7-18-6-2-3-8-22(18)21)25-16-23(28)26-19-11-13-20(14-12-19)27-15-5-10-24(27)29/h2-4,6-9,11-14,17,25H,5,10,15-16H2,1H3,(H,26,28)/p+1/t17-/m0/s1 |
| InChIKey | GKFXMGXHIPAKBQ-KRWDZBQOSA-O |
| XLogP | 3.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |