C24H28N3O+ — CID 9348920
[(1R)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium (PubChem CID 9348920) has the molecular formula C24H28N3O+ and a molecular weight of 374.51 g/mol. Its IUPAC name is [(1R)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium.
| Compound Name | [(1R)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9348920 |
| Molecular Formula | C24H28N3O+ |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | [(1R)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)N1CCN(c2ccccc2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27N3O/c1-19(22-13-7-9-20-8-5-6-12-23(20)22)25-18-24(28)27-16-14-26(15-17-27)21-10-3-2-4-11-21/h2-13,19,25H,14-18H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | VIEKTKYOJXKKNS-LJQANCHMSA-O |
| XLogP | 2.81 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |