C23H28N4O+2 — CID 8695435
[(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]azanium (PubChem CID 8695435) has the molecular formula C23H28N4O+2 and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]azanium.
| Compound Name | [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8695435 |
| Molecular Formula | C23H28N4O+2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(1S)-1-naphthalen-1-ylethyl]-[2-oxo-2-(4-pyridin-1-ium-2-ylpiperazin-1-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)N1CCN(c2cccc[nH+]2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H26N4O/c1-18(20-10-6-8-19-7-2-3-9-21(19)20)25-17-23(28)27-15-13-26(14-16-27)22-11-4-5-12-24-22/h2-12,18,25H,13-17H2,1H3/p+2/t18-/m0/s1 |
| InChIKey | GYLKOBGUXNVAQG-SFHVURJKSA-P |
| XLogP | 1.63 |
| TPSA | 54.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |