C23H31N4O2+ — CID 7318184
4-oxo-N-[(2R)-4-phenylbutan-2-yl]-4-(4-pyridin-1-ium-2-ylpiperazin-1-yl)butanamide (PubChem CID 7318184) has the molecular formula C23H31N4O2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-oxo-N-[(2R)-4-phenylbutan-2-yl]-4-(4-pyridin-1-ium-2-ylpiperazin-1-yl)butanamide.
| Compound Name | 4-oxo-N-[(2R)-4-phenylbutan-2-yl]-4-(4-pyridin-1-ium-2-ylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 7318184 |
| Molecular Formula | C23H31N4O2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-oxo-N-[(2R)-4-phenylbutan-2-yl]-4-(4-pyridin-1-ium-2-ylpiperazin-1-yl)butanamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)CCC(=O)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-19(10-11-20-7-3-2-4-8-20)25-22(28)12-13-23(29)27-17-15-26(16-18-27)21-9-5-6-14-24-21/h2-9,14,19H,10-13,15-18H2,1H3,(H,25,28)/p+1/t19-/m1/s1 |
| InChIKey | QKDOBRDDTBQGDK-LJQANCHMSA-O |
| XLogP | 2.07 |
| TPSA | 66.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |