C16H23N3O3 — CID 51362452
N-(2-amino-2-oxoethyl)-N'-(4-phenylbutan-2-yl)butanediamide (PubChem CID 51362452) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N'-(4-phenylbutan-2-yl)butanediamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N'-(4-phenylbutan-2-yl)butanediamide |
|---|---|
| PubChem CID | 51362452 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N'-(4-phenylbutan-2-yl)butanediamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CCC(=O)NCC(N)=O |
| InChI | InChI=1S/C16H23N3O3/c1-12(7-8-13-5-3-2-4-6-13)19-16(22)10-9-15(21)18-11-14(17)20/h2-6,12H,7-11H2,1H3,(H2,17,20)(H,18,21)(H,19,22) |
| InChIKey | SZBGGYVCXOZNID-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |