C16H20N3OS+ — CID 8851941
1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-3-thiophen-3-ylpropan-1-one (PubChem CID 8851941) has the molecular formula C16H20N3OS+ and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 8851941 |
| Molecular Formula | C16H20N3OS+ |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-(4-pyridin-1-ium-2-ylpiperazin-1-yl)-3-thiophen-3-ylpropan-1-one |
| SMILES | O=C(CCc1ccsc1)N1CCN(c2cccc[nH+]2)CC1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(5-4-14-6-12-21-13-14)19-10-8-18(9-11-19)15-3-1-2-7-17-15/h1-3,6-7,12-13H,4-5,8-11H2/p+1 |
| InChIKey | JJKASTDJNVXJFT-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 37.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |