C21H26F2N3O2+ — CID 8593616
[(1R)-1-(2,4-difluorophenyl)ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium (PubChem CID 8593616) has the molecular formula C21H26F2N3O2+ and a molecular weight of 390.45 g/mol. Its IUPAC name is [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8593616 |
| Molecular Formula | C21H26F2N3O2+ |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(1R)-1-(2,4-difluorophenyl)ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium |
| SMILES | COc1ccc(N2CCN(C(=O)C[NH2+][C@H](C)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-15(19-8-3-16(22)13-20(19)23)24-14-21(27)26-11-9-25(10-12-26)17-4-6-18(28-2)7-5-17/h3-8,13,15,24H,9-12,14H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | OIVIBDDPZDTBRX-OAHLLOKOSA-O |
| XLogP | 1.95 |
| TPSA | 49.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|