C22H34N3O2+ — CID 2557263
[(1S)-1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium (PubChem CID 2557263) has the molecular formula C22H34N3O2+ and a molecular weight of 372.53 g/mol. Its IUPAC name is [(1S)-1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2557263 |
| Molecular Formula | C22H34N3O2+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | [(1S)-1-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]azanium |
| SMILES | COc1ccc(N2CCN(C(=O)C[NH2+][C@@H](C)[C@@H]3C[C@@H]4CC[C@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c1-16(21-14-17-3-4-18(21)13-17)23-15-22(26)25-11-9-24(10-12-25)19-5-7-20(27-2)8-6-19/h5-8,16-18,21,23H,3-4,9-15H2,1-2H3/p+1/t16-,17+,18-,21-/m0/s1 |
| InChIKey | PGCRIIMGDBKTRY-NYUBLWNDSA-O |
| XLogP | 1.73 |
| TPSA | 49.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|