C18H22BrN2O3+ — CID 9001081
[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9001081) has the molecular formula C18H22BrN2O3+ and a molecular weight of 394.29 g/mol. Its IUPAC name is [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9001081 |
| Molecular Formula | C18H22BrN2O3+ |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+][C@H](C)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-12(13-4-9-17(24-3)16(19)10-13)20-11-18(22)21-14-5-7-15(23-2)8-6-14/h4-10,12,20H,11H2,1-3H3,(H,21,22)/p+1/t12-/m1/s1 |
| InChIKey | QGGSKZOWMBFQII-GFCCVEGCSA-O |
| XLogP | 2.73 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |