C19H21BrN3O2+ — CID 9001662
[(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]azanium (PubChem CID 9001662) has the molecular formula C19H21BrN3O2+ and a molecular weight of 403.30 g/mol. Its IUPAC name is [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9001662 |
| Molecular Formula | C19H21BrN3O2+ |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | [(1R)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]azanium |
| SMILES | COc1ccc([C@@H](C)[NH2+]CC(=O)Nc2ccc(CC#N)cc2)cc1Br |
| InChI | InChI=1S/C19H20BrN3O2/c1-13(15-5-8-18(25-2)17(20)11-15)22-12-19(24)23-16-6-3-14(4-7-16)9-10-21/h3-8,11,13,22H,9,12H2,1-2H3,(H,23,24)/p+1/t13-/m1/s1 |
| InChIKey | VVUJDVOCAAZQDR-CYBMUJFWSA-O |
| XLogP | 2.79 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |