C19H24BrN2O2+ — CID 9000991
[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-ethylanilino)-2-oxoethyl]azanium (PubChem CID 9000991) has the molecular formula C19H24BrN2O2+ and a molecular weight of 392.32 g/mol. Its IUPAC name is [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-ethylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-ethylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9000991 |
| Molecular Formula | C19H24BrN2O2+ |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[2-(4-ethylanilino)-2-oxoethyl]azanium |
| SMILES | CCc1ccc(NC(=O)C[NH2+][C@@H](C)c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C19H23BrN2O2/c1-4-14-5-8-16(9-6-14)22-19(23)12-21-13(2)15-7-10-18(24-3)17(20)11-15/h5-11,13,21H,4,12H2,1-3H3,(H,22,23)/p+1/t13-/m0/s1 |
| InChIKey | JBKUDIVKAQMLST-ZDUSSCGKSA-O |
| XLogP | 3.28 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |